About ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine
ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine (PubChem CID 142957611) has the molecular formula C18H27N
and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine.
Molecular Properties
| Compound Name | ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine |
| PubChem CID | 142957611 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine |
| SMILES | C=C(Cc1ccccc1)NC(/C=C\CC)=C/C.CC |
| InChI | InChI=1S/C16H21N.C2H6/c1-4-6-12-16(5-2)17-14(3)13-15-10-8-7-9-11-15;1-2/h5-12,17H,3-4,13H2,1-2H3;1-2H3/b12-6-,16-5+; |
| InChIKey | PJRNLWNKXCRZLK-MPCOYTMJSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine?
The IUPAC name of ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine (CID 142957611) is ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine.
What is the SMILES notation for ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine?
The canonical SMILES for ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine is C=C(Cc1ccccc1)NC(/C=C\CC)=C/C.CC.
What is the InChIKey of ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine?
The InChIKey is PJRNLWNKXCRZLK-MPCOYTMJSA-N. The full InChI is InChI=1S/C16H21N.C2H6/c1-4-6-12-16(5-2)17-14(3)13-15-10-8-7-9-11-15;1-2/h5-12,17H,3-4,13H2,1-2H3;1-2H3/b12-6-,16-5+;.
What are the key properties of ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine?
ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine has a molecular weight of 257.42 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine is sourced from PubChem (CID 142957611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).