C18H27N — CID 142957611
ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine (PubChem CID 142957611) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine.
| Compound Name | ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 142957611 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethane;(2E,4Z)-N-(3-phenylprop-1-en-2-yl)hepta-2,4-dien-3-amine |
| SMILES | C=C(Cc1ccccc1)NC(/C=C\CC)=C/C.CC |
| InChI | InChI=1S/C16H21N.C2H6/c1-4-6-12-16(5-2)17-14(3)13-15-10-8-7-9-11-15;1-2/h5-12,17H,3-4,13H2,1-2H3;1-2H3/b12-6-,16-5+; |
| InChIKey | PJRNLWNKXCRZLK-MPCOYTMJSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|