C32H49N — CID 144745862
ethane;(2Z,4E)-N-[(2E)-5-methylhexa-2,4-dien-3-yl]-1-(4-methylphenyl)hepta-2,4-dien-4-amine;toluene (PubChem CID 144745862) has the molecular formula C32H49N and a molecular weight of 447.75 g/mol. Its IUPAC name is ethane;(2Z,4E)-N-[(2E)-5-methylhexa-2,4-dien-3-yl]-1-(4-methylphenyl)hepta-2,4-dien-4-amine;toluene.
| Compound Name | ethane;(2Z,4E)-N-[(2E)-5-methylhexa-2,4-dien-3-yl]-1-(4-methylphenyl)hepta-2,4-dien-4-amine;toluene |
|---|---|
| PubChem CID | 144745862 |
| Molecular Formula | C32H49N |
| Molecular Weight | 447.75 g/mol |
| Exact Mass | 447.39 |
| IUPAC Name | ethane;(2Z,4E)-N-[(2E)-5-methylhexa-2,4-dien-3-yl]-1-(4-methylphenyl)hepta-2,4-dien-4-amine;toluene |
| SMILES | C/C=C(\C=C(C)C)NC(/C=C\Cc1ccc(C)cc1)=C/CC.CC.CC.Cc1ccccc1 |
| InChI | InChI=1S/C21H29N.C7H8.2C2H6/c1-6-9-21(22-20(7-2)16-17(3)4)11-8-10-19-14-12-18(5)13-15-19;1-7-5-3-2-4-6-7;2*1-2/h7-9,11-16,22H,6,10H2,1-5H3;2-6H,1H3;2*1-2H3/b11-8-,20-7+,21-9+;;; |
| InChIKey | FGJSXGJVZNHHFH-UUGOIIKXSA-N |
| XLogP | 9.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.75 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|