C14H17Cl — CID 102046771
1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methylbenzene (PubChem CID 102046771) has the molecular formula C14H17Cl and a molecular weight of 220.74 g/mol. Its IUPAC name is 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methylbenzene.
| Compound Name | 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 102046771 |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methylbenzene |
| SMILES | CC(C)=C(Cl)/C=C/Cc1ccc(C)cc1 |
| InChI | InChI=1S/C14H17Cl/c1-11(2)14(15)6-4-5-13-9-7-12(3)8-10-13/h4,6-10H,5H2,1-3H3/b6-4+ |
| InChIKey | QWBSODWYGQVECG-GQCTYLIASA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|