C14H17ClO — CID 102046770
1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methoxybenzene (PubChem CID 102046770) has the molecular formula C14H17ClO and a molecular weight of 236.74 g/mol. Its IUPAC name is 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102046770 |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-[(2E)-4-chloro-5-methylhexa-2,4-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(C/C=C/C(Cl)=C(C)C)cc1 |
| InChI | InChI=1S/C14H17ClO/c1-11(2)14(15)6-4-5-12-7-9-13(16-3)10-8-12/h4,6-10H,5H2,1-3H3/b6-4+ |
| InChIKey | VYTQCKXOOTYEHY-GQCTYLIASA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|