C19H28O — CID 88540925
1-[(2E,6E)-dodeca-2,6-dienyl]-4-methoxybenzene (PubChem CID 88540925) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-[(2E,6E)-dodeca-2,6-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(2E,6E)-dodeca-2,6-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 88540925 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-[(2E,6E)-dodeca-2,6-dienyl]-4-methoxybenzene |
| SMILES | CCCCC/C=C/CC/C=C/Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H28O/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-16-19(20-2)17-15-18/h7-8,11-12,14-17H,3-6,9-10,13H2,1-2H3/b8-7+,12-11+ |
| InChIKey | DUPAQRQDWOVTCS-NJHWEWLZSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|