C19H27NO2 — CID 14427405
(2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide (PubChem CID 14427405) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide |
|---|---|
| PubChem CID | 14427405 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2E,4E)-N-[2-(4-methoxyphenyl)ethyl]deca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27NO2/c1-3-4-5-6-7-8-9-10-19(21)20-16-15-17-11-13-18(22-2)14-12-17/h7-14H,3-6,15-16H2,1-2H3,(H,20,21)/b8-7+,10-9+ |
| InChIKey | WOVBLOXQMWZOCT-XBLVEGMJSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|