C16H21NO — CID 123644978
7-phenyl-N-propylhepta-2,4-dienamide (PubChem CID 123644978) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 7-phenyl-N-propylhepta-2,4-dienamide.
| Compound Name | 7-phenyl-N-propylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 123644978 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 7-phenyl-N-propylhepta-2,4-dienamide |
| SMILES | CCCNC(=O)C=CC=CCCc1ccccc1 |
| InChI | InChI=1S/C16H21NO/c1-2-14-17-16(18)13-9-4-3-6-10-15-11-7-5-8-12-15/h3-5,7-9,11-13H,2,6,10,14H2,1H3,(H,17,18) |
| InChIKey | SVCMRCXVLHPKSC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|