C16H20BrNO — CID 166438872
(2E,4E)-8-bromo-N-(2-phenylethyl)octa-2,4-dienamide (PubChem CID 166438872) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is (2E,4E)-8-bromo-N-(2-phenylethyl)octa-2,4-dienamide.
| Compound Name | (2E,4E)-8-bromo-N-(2-phenylethyl)octa-2,4-dienamide |
|---|---|
| PubChem CID | 166438872 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (2E,4E)-8-bromo-N-(2-phenylethyl)octa-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/CCCBr)NCCc1ccccc1 |
| InChI | InChI=1S/C16H20BrNO/c17-13-8-3-1-2-7-11-16(19)18-14-12-15-9-5-4-6-10-15/h1-2,4-7,9-11H,3,8,12-14H2,(H,18,19)/b2-1+,11-7+ |
| InChIKey | WWLRQPXAUFNRDF-IOHLXRPMSA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|