C18H25NO — CID 88614180
(2E)-7-(2-methylphenyl)-N-(2-methylpropyl)hepta-2,4-dienamide (PubChem CID 88614180) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (2E)-7-(2-methylphenyl)-N-(2-methylpropyl)hepta-2,4-dienamide.
| Compound Name | (2E)-7-(2-methylphenyl)-N-(2-methylpropyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 88614180 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2E)-7-(2-methylphenyl)-N-(2-methylpropyl)hepta-2,4-dienamide |
| SMILES | Cc1ccccc1CCC=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C18H25NO/c1-15(2)14-19-18(20)13-7-5-4-6-11-17-12-9-8-10-16(17)3/h4-5,7-10,12-13,15H,6,11,14H2,1-3H3,(H,19,20)/b5-4?,13-7+ |
| InChIKey | YYHILRGZKPZHCF-GVSYHEQVSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|