C19H28O2 — CID 46894337
1-methoxy-4-[(1E,3E)-2-methoxyundeca-1,3-dienyl]benzene (PubChem CID 46894337) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-methoxy-4-[(1E,3E)-2-methoxyundeca-1,3-dienyl]benzene.
| Compound Name | 1-methoxy-4-[(1E,3E)-2-methoxyundeca-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 46894337 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-methoxy-4-[(1E,3E)-2-methoxyundeca-1,3-dienyl]benzene |
| SMILES | CCCCCCC/C=C/C(=C\c1ccc(OC)cc1)OC |
| InChI | InChI=1S/C19H28O2/c1-4-5-6-7-8-9-10-11-19(21-3)16-17-12-14-18(20-2)15-13-17/h10-16H,4-9H2,1-3H3/b11-10+,19-16+ |
| InChIKey | IWXTXRVHLXVDEW-WEGNKRRCSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|