About 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene
1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene (PubChem CID 159696317) has the molecular formula C21H27IO
and a molecular weight of 422.35 g/mol. Its IUPAC name is 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene |
| PubChem CID | 159696317 |
| Molecular Formula | C21H27IO |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene |
| SMILES | CCCCC/C=C\c1ccc(OC)cc1.Cc1ccc(I)cc1 |
| InChI | InChI=1S/C14H20O.C7H7I/c1-3-4-5-6-7-8-13-9-11-14(15-2)12-10-13;1-6-2-4-7(8)5-3-6/h7-12H,3-6H2,1-2H3;2-5H,1H3/b8-7-; |
| InChIKey | MXBBHOQGOUVYJL-CFYXSCKTSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene?
The IUPAC name of 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene (CID 159696317) is 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene.
What is the SMILES notation for 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene?
The canonical SMILES for 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene is CCCCC/C=C\c1ccc(OC)cc1.Cc1ccc(I)cc1.
What is the InChIKey of 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene?
The InChIKey is MXBBHOQGOUVYJL-CFYXSCKTSA-N. The full InChI is InChI=1S/C14H20O.C7H7I/c1-3-4-5-6-7-8-13-9-11-14(15-2)12-10-13;1-6-2-4-7(8)5-3-6/h7-12H,3-6H2,1-2H3;2-5H,1H3/b8-7-;.
What are the key properties of 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene?
1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene has a molecular weight of 422.35 g/mol, XLogP of 6.89, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-hept-1-enyl]-4-methoxybenzene;1-iodo-4-methylbenzene is sourced from PubChem (CID 159696317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).