C20H29F3O — CID 122222389
1-methoxy-4-[(Z)-1,1,1-trifluorotridec-2-en-2-yl]benzene (PubChem CID 122222389) has the molecular formula C20H29F3O and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-methoxy-4-[(Z)-1,1,1-trifluorotridec-2-en-2-yl]benzene.
| Compound Name | 1-methoxy-4-[(Z)-1,1,1-trifluorotridec-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 122222389 |
| Molecular Formula | C20H29F3O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-methoxy-4-[(Z)-1,1,1-trifluorotridec-2-en-2-yl]benzene |
| SMILES | CCCCCCCCCC/C=C(/c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H29F3O/c1-3-4-5-6-7-8-9-10-11-12-19(20(21,22)23)17-13-15-18(24-2)16-14-17/h12-16H,3-11H2,1-2H3/b19-12- |
| InChIKey | BXZBFHOWVRWJBV-UNOMPAQXSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|