C20H22O3 — CID 164676362
1-methoxy-4-[(1Z,3E)-1-methoxy-5-(4-methoxyphenyl)penta-1,3-dienyl]benzene (PubChem CID 164676362) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-methoxy-4-[(1Z,3E)-1-methoxy-5-(4-methoxyphenyl)penta-1,3-dienyl]benzene.
| Compound Name | 1-methoxy-4-[(1Z,3E)-1-methoxy-5-(4-methoxyphenyl)penta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 164676362 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-methoxy-4-[(1Z,3E)-1-methoxy-5-(4-methoxyphenyl)penta-1,3-dienyl]benzene |
| SMILES | CO/C(=C\C=C\Cc1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22O3/c1-21-18-12-8-16(9-13-18)6-4-5-7-20(23-3)17-10-14-19(22-2)15-11-17/h4-5,7-15H,6H2,1-3H3/b5-4+,20-7- |
| InChIKey | PHJDWMLNVLAJSU-PQVWQCQBSA-N |
| XLogP | 4.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|