C21H24 — CID 59812345
1-methyl-4-[4-[(2Z,6Z)-octa-2,6-dienyl]phenyl]benzene (PubChem CID 59812345) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2Z,6Z)-octa-2,6-dienyl]phenyl]benzene.
| Compound Name | 1-methyl-4-[4-[(2Z,6Z)-octa-2,6-dienyl]phenyl]benzene |
|---|---|
| PubChem CID | 59812345 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 1-methyl-4-[4-[(2Z,6Z)-octa-2,6-dienyl]phenyl]benzene |
| SMILES | C/C=C\CC/C=C\Cc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H24/c1-3-4-5-6-7-8-9-19-12-16-21(17-13-19)20-14-10-18(2)11-15-20/h3-4,7-8,10-17H,5-6,9H2,1-2H3/b4-3-,8-7- |
| InChIKey | JIGDLZYVCVGWBP-KPDBFRNYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|