C31H34 — CID 140774680
1-[4-[(E)-but-2-enyl]phenyl]-4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]benzene (PubChem CID 140774680) has the molecular formula C31H34 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[4-[(E)-but-2-enyl]phenyl]-4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]benzene.
| Compound Name | 1-[4-[(E)-but-2-enyl]phenyl]-4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]benzene |
|---|---|
| PubChem CID | 140774680 |
| Molecular Formula | C31H34 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[4-[(E)-but-2-enyl]phenyl]-4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]benzene |
| SMILES | C/C=C/CCc1ccc(C/C=C/Cc2ccc(-c3ccc(C/C=C/C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H34/c1-3-5-7-11-27-14-16-28(17-15-27)12-8-9-13-29-20-24-31(25-21-29)30-22-18-26(19-23-30)10-6-4-2/h3-6,8-9,14-25H,7,10-13H2,1-2H3/b5-3+,6-4+,9-8+ |
| InChIKey | PECPQIFZFKJXNY-RFWMKXCQSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|