C34H40 — CID 140774698
1-[(E)-pent-3-enyl]-4-[2-[4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]phenyl]ethyl]benzene (PubChem CID 140774698) has the molecular formula C34H40 and a molecular weight of 448.69 g/mol. Its IUPAC name is 1-[(E)-pent-3-enyl]-4-[2-[4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]phenyl]ethyl]benzene.
| Compound Name | 1-[(E)-pent-3-enyl]-4-[2-[4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 140774698 |
| Molecular Formula | C34H40 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 1-[(E)-pent-3-enyl]-4-[2-[4-[(E)-4-[4-[(E)-pent-3-enyl]phenyl]but-2-enyl]phenyl]ethyl]benzene |
| SMILES | C/C=C/CCc1ccc(C/C=C/Cc2ccc(CCc3ccc(CC/C=C/C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H40/c1-3-5-7-11-29-15-17-31(18-16-29)13-9-10-14-32-21-25-34(26-22-32)28-27-33-23-19-30(20-24-33)12-8-6-4-2/h3-6,9-10,15-26H,7-8,11-14,27-28H2,1-2H3/b5-3+,6-4+,10-9+ |
| InChIKey | IKMBICXQWIHVQQ-MZCOLXIVSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|