C15H20 — CID 123258139
1-methyl-2-octa-2,6-dienylbenzene (PubChem CID 123258139) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-methyl-2-octa-2,6-dienylbenzene.
| Compound Name | 1-methyl-2-octa-2,6-dienylbenzene |
|---|---|
| PubChem CID | 123258139 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-methyl-2-octa-2,6-dienylbenzene |
| SMILES | CC=CCCC=CCc1ccccc1C |
| InChI | InChI=1S/C15H20/c1-3-4-5-6-7-8-12-15-13-10-9-11-14(15)2/h3-4,7-11,13H,5-6,12H2,1-2H3 |
| InChIKey | ZXLPMJBTDOKGDE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|