About 1-methyl-2-prop-2-enylbenzene;sulfane
1-methyl-2-prop-2-enylbenzene;sulfane (PubChem CID 174918280) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 1-methyl-2-prop-2-enylbenzene;sulfane.
Molecular Properties
| Compound Name | 1-methyl-2-prop-2-enylbenzene;sulfane |
| PubChem CID | 174918280 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-methyl-2-prop-2-enylbenzene;sulfane |
| SMILES | C=CCc1ccccc1C.S |
| InChI | InChI=1S/C10H12.H2S/c1-3-6-10-8-5-4-7-9(10)2;/h3-5,7-8H,1,6H2,2H3;1H2 |
| InChIKey | YTIONVBMTJHVES-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-prop-2-enylbenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-prop-2-enylbenzene;sulfane?
The IUPAC name of 1-methyl-2-prop-2-enylbenzene;sulfane (CID 174918280) is 1-methyl-2-prop-2-enylbenzene;sulfane.
What is the SMILES notation for 1-methyl-2-prop-2-enylbenzene;sulfane?
The canonical SMILES for 1-methyl-2-prop-2-enylbenzene;sulfane is C=CCc1ccccc1C.S.
What is the InChIKey of 1-methyl-2-prop-2-enylbenzene;sulfane?
The InChIKey is YTIONVBMTJHVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.H2S/c1-3-6-10-8-5-4-7-9(10)2;/h3-5,7-8H,1,6H2,2H3;1H2.
What are the key properties of 1-methyl-2-prop-2-enylbenzene;sulfane?
1-methyl-2-prop-2-enylbenzene;sulfane has a molecular weight of 166.29 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-prop-2-enylbenzene;sulfane is sourced from PubChem (CID 174918280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).