About trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane
trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane (PubChem CID 57072834) has the molecular formula C16H24Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane |
| PubChem CID | 57072834 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane |
| SMILES | C=CC(C=CCc1ccccc1C)[Si](C)(C)C |
| InChI | InChI=1S/C16H24Si/c1-6-16(17(3,4)5)13-9-12-15-11-8-7-10-14(15)2/h6-11,13,16H,1,12H2,2-5H3 |
| InChIKey | RIQMUDMKDWUERV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane?
The IUPAC name of trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane (CID 57072834) is trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane.
What is the SMILES notation for trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane?
The canonical SMILES for trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane is C=CC(C=CCc1ccccc1C)[Si](C)(C)C.
What is the InChIKey of trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane?
The InChIKey is RIQMUDMKDWUERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Si/c1-6-16(17(3,4)5)13-9-12-15-11-8-7-10-14(15)2/h6-11,13,16H,1,12H2,2-5H3.
What are the key properties of trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane?
trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane has a molecular weight of 244.45 g/mol, XLogP of 4.99, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane is sourced from PubChem (CID 57072834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).