C16H24Si — CID 57072834
trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane (PubChem CID 57072834) has the molecular formula C16H24Si and a molecular weight of 244.45 g/mol. Its IUPAC name is trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane.
| Compound Name | trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane |
|---|---|
| PubChem CID | 57072834 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | trimethyl-[6-(2-methylphenyl)hexa-1,4-dien-3-yl]silane |
| SMILES | C=CC(C=CCc1ccccc1C)[Si](C)(C)C |
| InChI | InChI=1S/C16H24Si/c1-6-16(17(3,4)5)13-9-12-15-11-8-7-10-14(15)2/h6-11,13,16H,1,12H2,2-5H3 |
| InChIKey | RIQMUDMKDWUERV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|