About ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine
ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine (PubChem CID 145328256) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine.
Molecular Properties
| Compound Name | ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine |
| PubChem CID | 145328256 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine |
| SMILES | C/C=C(/Cc1ccccc1)NCC.C=C.C=C |
| InChI | InChI=1S/C12H17N.2C2H4/c1-3-12(13-4-2)10-11-8-6-5-7-9-11;2*1-2/h3,5-9,13H,4,10H2,1-2H3;2*1-2H2/b12-3-;; |
| InChIKey | IMDZJBIFYOFSDJ-WRHBBANNSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine?
The IUPAC name of ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine (CID 145328256) is ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine.
What is the SMILES notation for ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine?
The canonical SMILES for ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine is C/C=C(/Cc1ccccc1)NCC.C=C.C=C.
What is the InChIKey of ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine?
The InChIKey is IMDZJBIFYOFSDJ-WRHBBANNSA-N. The full InChI is InChI=1S/C12H17N.2C2H4/c1-3-12(13-4-2)10-11-8-6-5-7-9-11;2*1-2/h3,5-9,13H,4,10H2,1-2H3;2*1-2H2/b12-3-;;.
What are the key properties of ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine?
ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine has a molecular weight of 231.38 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(Z)-N-ethyl-1-phenylbut-2-en-2-amine is sourced from PubChem (CID 145328256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).