C14H19NO — CID 146261857
(2E,4E)-4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]hepta-2,4,6-trien-2-ol (PubChem CID 146261857) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (2E,4E)-4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]hepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4E)-4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 146261857 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2E,4E)-4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C=C(\C=C/C)NC(/C=C(\C)O)=C/C=C |
| InChI | InChI=1S/C14H19NO/c1-5-8-13(9-6-2)15-14(10-7-3)11-12(4)16/h5-11,15-16H,1,3H2,2,4H3/b9-6-,12-11+,13-8+,14-10+ |
| InChIKey | GYWQZUCPAQVESC-TYWDGXOTSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|