C9H15NO — CID 142933959
2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]ethanol (PubChem CID 142933959) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]ethanol.
| Compound Name | 2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 142933959 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]ethanol |
| SMILES | C=C/C=C(\C=C/C)NCCO |
| InChI | InChI=1S/C9H15NO/c1-3-5-9(6-4-2)10-7-8-11/h3-6,10-11H,1,7-8H2,2H3/b6-4-,9-5+ |
| InChIKey | DECBVSUYLPFJGF-QUNSIMLLSA-N |
| XLogP | 1.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|