C13H25N3O2 — CID 142114218
acetonitrile;2-[[(1E,3E,5Z)-1-aminohepta-1,3,5-trien-4-yl]amino]ethanol;ethanol (PubChem CID 142114218) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is acetonitrile;2-[[(1E,3E,5Z)-1-aminohepta-1,3,5-trien-4-yl]amino]ethanol;ethanol.
| Compound Name | acetonitrile;2-[[(1E,3E,5Z)-1-aminohepta-1,3,5-trien-4-yl]amino]ethanol;ethanol |
|---|---|
| PubChem CID | 142114218 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | acetonitrile;2-[[(1E,3E,5Z)-1-aminohepta-1,3,5-trien-4-yl]amino]ethanol;ethanol |
| SMILES | C/C=C\C(=C/C=C/N)NCCO.CC#N.CCO |
| InChI | InChI=1S/C9H16N2O.C2H3N.C2H6O/c1-2-4-9(5-3-6-10)11-7-8-12;2*1-2-3/h2-6,11-12H,7-8,10H2,1H3;1H3;3H,2H2,1H3/b4-2-,6-3+,9-5+;; |
| InChIKey | QBCXYJIMBDCWDO-IQVFANFISA-N |
| XLogP | 1.03 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|