About CID 158513975
CID 158513975 (PubChem CID 158513975) has the molecular formula C8H17BNO2
and a molecular weight of 170.04 g/mol.
Molecular Properties
| Compound Name | CID 158513975 |
| PubChem CID | 158513975 |
| Molecular Formula | C8H17BNO2 |
| Molecular Weight | 170.04 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | — |
| SMILES | C.CC=CCC(=O)NCCO.[B] |
| InChI | InChI=1S/C7H13NO2.CH4.B/c1-2-3-4-7(10)8-5-6-9;;/h2-3,9H,4-6H2,1H3,(H,8,10);1H4; |
| InChIKey | KEHUDPGSALFTIF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.04 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 158513975 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158513975?
The IUPAC name of CID 158513975 (CID 158513975) is not available.
What is the SMILES notation for CID 158513975?
The canonical SMILES for CID 158513975 is C.CC=CCC(=O)NCCO.[B].
What is the InChIKey of CID 158513975?
The InChIKey is KEHUDPGSALFTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.CH4.B/c1-2-3-4-7(10)8-5-6-9;;/h2-3,9H,4-6H2,1H3,(H,8,10);1H4;.
What are the key properties of CID 158513975?
CID 158513975 has a molecular weight of 170.04 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158513975 is sourced from PubChem (CID 158513975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).