C10H21NO2Si — CID 11413268
(E)-N-(2-hydroxyethyl)-5-trimethylsilylpent-4-enamide (PubChem CID 11413268) has the molecular formula C10H21NO2Si and a molecular weight of 215.37 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-5-trimethylsilylpent-4-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-5-trimethylsilylpent-4-enamide |
|---|---|
| PubChem CID | 11413268 |
| Molecular Formula | C10H21NO2Si |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-5-trimethylsilylpent-4-enamide |
| SMILES | C[Si](C)(C)/C=C/CCC(=O)NCCO |
| InChI | InChI=1S/C10H21NO2Si/c1-14(2,3)9-5-4-6-10(13)11-7-8-12/h5,9,12H,4,6-8H2,1-3H3,(H,11,13)/b9-5+ |
| InChIKey | NBSRUFSIONOTAY-WEVVVXLNSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|