C12H18N2OS — CID 171145739
N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pent-3-enamide (PubChem CID 171145739) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pent-3-enamide.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pent-3-enamide |
|---|---|
| PubChem CID | 171145739 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pent-3-enamide |
| SMILES | CC=CCC(=O)NCCCc1nc(C)cs1 |
| InChI | InChI=1S/C12H18N2OS/c1-3-4-6-11(15)13-8-5-7-12-14-10(2)9-16-12/h3-4,9H,5-8H2,1-2H3,(H,13,15) |
| InChIKey | PLNGCDHZIKCBCE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|