C16H23Cl2N3OS — CID 119875296
2-(4-aminophenyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]acetamide;dihydrochloride (PubChem CID 119875296) has the molecular formula C16H23Cl2N3OS and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119875296 |
| Molecular Formula | C16H23Cl2N3OS |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-(4-aminophenyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]acetamide;dihydrochloride |
| SMILES | Cc1csc(CCCCNC(=O)Cc2ccc(N)cc2)n1.Cl.Cl |
| InChI | InChI=1S/C16H21N3OS.2ClH/c1-12-11-21-16(19-12)4-2-3-9-18-15(20)10-13-5-7-14(17)8-6-13;;/h5-8,11H,2-4,9-10,17H2,1H3,(H,18,20);2*1H |
| InChIKey | HCRGGBSWJTYSLN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|