C7H10IN — CID 144727165
(3E,5Z)-N-iodohepta-1,3,5-trien-4-amine (PubChem CID 144727165) has the molecular formula C7H10IN and a molecular weight of 235.07 g/mol. Its IUPAC name is (3E,5Z)-N-iodohepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-iodohepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144727165 |
| Molecular Formula | C7H10IN |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | (3E,5Z)-N-iodohepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)NI |
| InChI | InChI=1S/C7H10IN/c1-3-5-7(9-8)6-4-2/h3-6,9H,1H2,2H3/b6-4-,7-5+ |
| InChIKey | BUCFXWGODICUFI-XGXWUAJZSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|