C16H22N2O — CID 142824224
(3E)-2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-3-[(Z)-prop-1-enyl]hexa-3,5-dienamide (PubChem CID 142824224) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (3E)-2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-3-[(Z)-prop-1-enyl]hexa-3,5-dienamide.
| Compound Name | (3E)-2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-3-[(Z)-prop-1-enyl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 142824224 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (3E)-2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]-3-[(Z)-prop-1-enyl]hexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C/C)NC(C(N)=O)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C16H22N2O/c1-5-9-13(10-6-2)15(16(17)19)18-14(11-7-3)12-8-4/h5-12,15,18H,1,3H2,2,4H3,(H2,17,19)/b10-6-,12-8-,13-9+,14-11+ |
| InChIKey | FMHMYYYKUZABIH-PNLGLICCSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|