C16H24O — CID 156838266
ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-ol (PubChem CID 156838266) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-ol.
| Compound Name | ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-ol |
|---|---|
| PubChem CID | 156838266 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | ethane;(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-ol |
| SMILES | C=C/C=C(\C=C)C(O)C(/C=C\C)=C/C=C.CC |
| InChI | InChI=1S/C14H18O.C2H6/c1-5-9-12(8-4)14(15)13(10-6-2)11-7-3;1-2/h5-11,14-15H,1-2,4H2,3H3;1-2H3/b11-7-,12-9+,13-10+; |
| InChIKey | ATPQGSLXSVUJIK-RCEJOEOESA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|