C19H30 — CID 143204941
ethane;[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene (PubChem CID 143204941) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is ethane;[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene.
| Compound Name | ethane;[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 143204941 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | ethane;[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)C(C)c1ccccc1.CC.CC |
| InChI | InChI=1S/C15H18.2C2H6/c1-4-9-14(10-5-2)13(3)15-11-7-6-8-12-15;2*1-2/h4-13H,1H2,2-3H3;2*1-2H3/b10-5-,14-9+;; |
| InChIKey | HKVIMWHPXCMQSO-SMSBJCJJSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|