C15H16O — CID 142139727
(4E)-4-ethenyl-3-phenylhepta-1,4,6-trien-2-ol (PubChem CID 142139727) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (4E)-4-ethenyl-3-phenylhepta-1,4,6-trien-2-ol.
| Compound Name | (4E)-4-ethenyl-3-phenylhepta-1,4,6-trien-2-ol |
|---|---|
| PubChem CID | 142139727 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (4E)-4-ethenyl-3-phenylhepta-1,4,6-trien-2-ol |
| SMILES | C=C/C=C(\C=C)C(C(=C)O)c1ccccc1 |
| InChI | InChI=1S/C15H16O/c1-4-9-13(5-2)15(12(3)16)14-10-7-6-8-11-14/h4-11,15-16H,1-3H2/b13-9+ |
| InChIKey | GQACXSNWNSAPOR-UKTHLTGXSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|