C14H19N3 — CID 144964111
N-[(2E)-2-ethenyl-1-(2-methylhydrazinyl)penta-2,4-dienyl]aniline (PubChem CID 144964111) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-[(2E)-2-ethenyl-1-(2-methylhydrazinyl)penta-2,4-dienyl]aniline.
| Compound Name | N-[(2E)-2-ethenyl-1-(2-methylhydrazinyl)penta-2,4-dienyl]aniline |
|---|---|
| PubChem CID | 144964111 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-[(2E)-2-ethenyl-1-(2-methylhydrazinyl)penta-2,4-dienyl]aniline |
| SMILES | C=C/C=C(\C=C)C(NNC)Nc1ccccc1 |
| InChI | InChI=1S/C14H19N3/c1-4-9-12(5-2)14(17-15-3)16-13-10-7-6-8-11-13/h4-11,14-17H,1-2H2,3H3/b12-9+ |
| InChIKey | SKDKDCPPXAFGGY-FMIVXFBMSA-N |
| XLogP | 2.45 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|