C13H17N — CID 88908793
N-[(4Z)-hepta-4,6-dien-3-yl]aniline (PubChem CID 88908793) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-[(4Z)-hepta-4,6-dien-3-yl]aniline.
| Compound Name | N-[(4Z)-hepta-4,6-dien-3-yl]aniline |
|---|---|
| PubChem CID | 88908793 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-[(4Z)-hepta-4,6-dien-3-yl]aniline |
| SMILES | C=C/C=C\C(CC)Nc1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h3,5-12,14H,1,4H2,2H3/b9-5- |
| InChIKey | QGIKPHIYIOBEEX-UITAMQMPSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|