C15H19N3 — CID 66809670
4-N-(1-aminopropyl)-1-N-phenylbenzene-1,4-diamine (PubChem CID 66809670) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-N-(1-aminopropyl)-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-(1-aminopropyl)-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 66809670 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-N-(1-aminopropyl)-1-N-phenylbenzene-1,4-diamine |
| SMILES | CCC(N)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H19N3/c1-2-15(16)18-14-10-8-13(9-11-14)17-12-6-4-3-5-7-12/h3-11,15,17-18H,2,16H2,1H3 |
| InChIKey | JAMYNRHMYWAFLR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|