C9H14N2O — CID 139645747
2-methoxy-1-N'-phenylethane-1,1-diamine (PubChem CID 139645747) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-methoxy-1-N'-phenylethane-1,1-diamine.
| Compound Name | 2-methoxy-1-N'-phenylethane-1,1-diamine |
|---|---|
| PubChem CID | 139645747 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-methoxy-1-N'-phenylethane-1,1-diamine |
| SMILES | COCC(N)Nc1ccccc1 |
| InChI | InChI=1S/C9H14N2O/c1-12-7-9(10)11-8-5-3-2-4-6-8/h2-6,9,11H,7,10H2,1H3 |
| InChIKey | MCYADVPJNFQROF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|