C18H26N2O3Si — CID 151836311
3-[dimethoxy(phenylmethoxy)silyl]-1-N'-phenylpropane-1,1-diamine (PubChem CID 151836311) has the molecular formula C18H26N2O3Si and a molecular weight of 346.50 g/mol. Its IUPAC name is 3-[dimethoxy(phenylmethoxy)silyl]-1-N'-phenylpropane-1,1-diamine.
| Compound Name | 3-[dimethoxy(phenylmethoxy)silyl]-1-N'-phenylpropane-1,1-diamine |
|---|---|
| PubChem CID | 151836311 |
| Molecular Formula | C18H26N2O3Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-[dimethoxy(phenylmethoxy)silyl]-1-N'-phenylpropane-1,1-diamine |
| SMILES | CO[Si](CCC(N)Nc1ccccc1)(OC)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3Si/c1-21-24(22-2,23-15-16-9-5-3-6-10-16)14-13-18(19)20-17-11-7-4-8-12-17/h3-12,18,20H,13-15,19H2,1-2H3 |
| InChIKey | SFSNHFLBTJFCDH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|