C15H28N2O3Si — CID 140645888
1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpropan-2-amine (PubChem CID 140645888) has the molecular formula C15H28N2O3Si and a molecular weight of 312.49 g/mol. Its IUPAC name is 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpropan-2-amine.
| Compound Name | 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpropan-2-amine |
|---|---|
| PubChem CID | 140645888 |
| Molecular Formula | C15H28N2O3Si |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpropan-2-amine |
| SMILES | CO[Si](CCCN)(OC)OCC(C)NCc1ccccc1 |
| InChI | InChI=1S/C15H28N2O3Si/c1-14(17-12-15-8-5-4-6-9-15)13-20-21(18-2,19-3)11-7-10-16/h4-6,8-9,14,17H,7,10-13,16H2,1-3H3 |
| InChIKey | YRQDSIAAMHXALC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|