C17H30N2O3Si — CID 68631769
3-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpent-4-en-1-amine (PubChem CID 68631769) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 3-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpent-4-en-1-amine.
| Compound Name | 3-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpent-4-en-1-amine |
|---|---|
| PubChem CID | 68631769 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzylpent-4-en-1-amine |
| SMILES | C=CC(CCNCc1ccccc1)O[Si](CCCN)(OC)OC |
| InChI | InChI=1S/C17H30N2O3Si/c1-4-17(22-23(20-2,21-3)14-8-12-18)11-13-19-15-16-9-6-5-7-10-16/h4-7,9-10,17,19H,1,8,11-15,18H2,2-3H3 |
| InChIKey | HPTIOUARDYPMOF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|