C17H31ClN2O3Si — CID 141374135
3-[3-(ethenylamino)propyl-dimethoxysilyl]oxy-4-phenylbutan-1-amine;hydrochloride (PubChem CID 141374135) has the molecular formula C17H31ClN2O3Si and a molecular weight of 374.99 g/mol. Its IUPAC name is 3-[3-(ethenylamino)propyl-dimethoxysilyl]oxy-4-phenylbutan-1-amine;hydrochloride.
| Compound Name | 3-[3-(ethenylamino)propyl-dimethoxysilyl]oxy-4-phenylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 141374135 |
| Molecular Formula | C17H31ClN2O3Si |
| Molecular Weight | 374.99 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-[3-(ethenylamino)propyl-dimethoxysilyl]oxy-4-phenylbutan-1-amine;hydrochloride |
| SMILES | C=CNCCC[Si](OC)(OC)OC(CCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C17H30N2O3Si.ClH/c1-4-19-13-8-14-23(20-2,21-3)22-17(11-12-18)15-16-9-6-5-7-10-16;/h4-7,9-10,17,19H,1,8,11-15,18H2,2-3H3;1H |
| InChIKey | ACAZETZQOYMARV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.99 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|