C20H37ClN2O3Si — CID 167430995
3-[3-(ethenylamino)propyl-diethoxysilyl]oxy-3-methyl-4-phenylbutan-1-amine;hydrochloride (PubChem CID 167430995) has the molecular formula C20H37ClN2O3Si and a molecular weight of 417.07 g/mol. Its IUPAC name is 3-[3-(ethenylamino)propyl-diethoxysilyl]oxy-3-methyl-4-phenylbutan-1-amine;hydrochloride.
| Compound Name | 3-[3-(ethenylamino)propyl-diethoxysilyl]oxy-3-methyl-4-phenylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 167430995 |
| Molecular Formula | C20H37ClN2O3Si |
| Molecular Weight | 417.07 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[3-(ethenylamino)propyl-diethoxysilyl]oxy-3-methyl-4-phenylbutan-1-amine;hydrochloride |
| SMILES | C=CNCCC[Si](OCC)(OCC)OC(C)(CCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C20H36N2O3Si.ClH/c1-5-22-16-11-17-26(23-6-2,24-7-3)25-20(4,14-15-21)18-19-12-9-8-10-13-19;/h5,8-10,12-13,22H,1,6-7,11,14-18,21H2,2-4H3;1H |
| InChIKey | ADZYSSIWYNZDKU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|