C18H34N2O3Si — CID 175434467
3-[3-aminopropyl(diethoxy)silyl]oxy-1-phenylpentan-3-amine (PubChem CID 175434467) has the molecular formula C18H34N2O3Si and a molecular weight of 354.57 g/mol. Its IUPAC name is 3-[3-aminopropyl(diethoxy)silyl]oxy-1-phenylpentan-3-amine.
| Compound Name | 3-[3-aminopropyl(diethoxy)silyl]oxy-1-phenylpentan-3-amine |
|---|---|
| PubChem CID | 175434467 |
| Molecular Formula | C18H34N2O3Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 3-[3-aminopropyl(diethoxy)silyl]oxy-1-phenylpentan-3-amine |
| SMILES | CCO[Si](CCCN)(OCC)OC(N)(CC)CCc1ccccc1 |
| InChI | InChI=1S/C18H34N2O3Si/c1-4-18(20,14-13-17-11-8-7-9-12-17)23-24(21-5-2,22-6-3)16-10-15-19/h7-9,11-12H,4-6,10,13-16,19-20H2,1-3H3 |
| InChIKey | ZQVYSKNSCYWECI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|