C16H31NO2Si2 — CID 175152153
3-[1-[dimethyl(phenyl)silyl]ethoxy-ethoxy-methylsilyl]propan-1-amine (PubChem CID 175152153) has the molecular formula C16H31NO2Si2 and a molecular weight of 325.60 g/mol. Its IUPAC name is 3-[1-[dimethyl(phenyl)silyl]ethoxy-ethoxy-methylsilyl]propan-1-amine.
| Compound Name | 3-[1-[dimethyl(phenyl)silyl]ethoxy-ethoxy-methylsilyl]propan-1-amine |
|---|---|
| PubChem CID | 175152153 |
| Molecular Formula | C16H31NO2Si2 |
| Molecular Weight | 325.60 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 3-[1-[dimethyl(phenyl)silyl]ethoxy-ethoxy-methylsilyl]propan-1-amine |
| SMILES | CCO[Si](C)(CCCN)OC(C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H31NO2Si2/c1-6-18-21(5,14-10-13-17)19-15(2)20(3,4)16-11-8-7-9-12-16/h7-9,11-12,15H,6,10,13-14,17H2,1-5H3 |
| InChIKey | JMKVLQXKRXZHNT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|