C12H31N3O2Si — CID 141116193
N'-[3-(3-aminopropyl-ethoxy-methylsilyl)oxybutyl]ethane-1,2-diamine (PubChem CID 141116193) has the molecular formula C12H31N3O2Si and a molecular weight of 277.49 g/mol. Its IUPAC name is N'-[3-(3-aminopropyl-ethoxy-methylsilyl)oxybutyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(3-aminopropyl-ethoxy-methylsilyl)oxybutyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 141116193 |
| Molecular Formula | C12H31N3O2Si |
| Molecular Weight | 277.49 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N'-[3-(3-aminopropyl-ethoxy-methylsilyl)oxybutyl]ethane-1,2-diamine |
| SMILES | CCO[Si](C)(CCCN)OC(C)CCNCCN |
| InChI | InChI=1S/C12H31N3O2Si/c1-4-16-18(3,11-5-7-13)17-12(2)6-9-15-10-8-14/h12,15H,4-11,13-14H2,1-3H3 |
| InChIKey | WKBVAZSXHWQFFO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|