About 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate
5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate (PubChem CID 141125272) has the molecular formula C18H44N2O7Si2
and a molecular weight of 456.73 g/mol. Its IUPAC name is 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate.
Molecular Properties
| Compound Name | 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate |
| PubChem CID | 141125272 |
| Molecular Formula | C18H44N2O7Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate |
| SMILES | CCO[Si](OCC)(OC(C)CCCN)O[Si](OCC)(OCC)OC(C)CCCN |
| InChI | InChI=1S/C18H44N2O7Si2/c1-7-21-28(22-8-2,25-17(5)13-11-15-19)27-29(23-9-3,24-10-4)26-18(6)14-12-16-20/h17-18H,7-16,19-20H2,1-6H3 |
| InChIKey | GDVWDCVCRVDGQN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate?
The IUPAC name of 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate (CID 141125272) is 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate.
What is the SMILES notation for 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate?
The canonical SMILES for 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate is CCO[Si](OCC)(OC(C)CCCN)O[Si](OCC)(OCC)OC(C)CCCN.
What is the InChIKey of 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate?
The InChIKey is GDVWDCVCRVDGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H44N2O7Si2/c1-7-21-28(22-8-2,25-17(5)13-11-15-19)27-29(23-9-3,24-10-4)26-18(6)14-12-16-20/h17-18H,7-16,19-20H2,1-6H3.
What are the key properties of 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate?
5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate has a molecular weight of 456.73 g/mol, XLogP of 2.31, 20 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentan-2-yl [5-aminopentan-2-yloxy(diethoxy)silyl] diethyl silicate is sourced from PubChem (CID 141125272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).