About (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene
(4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene (PubChem CID 174801068) has the molecular formula C18H35NO5Si
and a molecular weight of 373.57 g/mol. Its IUPAC name is (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene.
Molecular Properties
| Compound Name | (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene |
| PubChem CID | 174801068 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene |
| SMILES | CCOC(CCCN)O[Si](OC)(OCC)OCC.Cc1ccccc1 |
| InChI | InChI=1S/C11H27NO5Si.C7H8/c1-5-14-11(9-8-10-12)17-18(13-4,15-6-2)16-7-3;1-7-5-3-2-4-6-7/h11H,5-10,12H2,1-4H3;2-6H,1H3 |
| InChIKey | MSPUYUOBSMKXCN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene?
The IUPAC name of (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene (CID 174801068) is (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene.
What is the SMILES notation for (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene?
The canonical SMILES for (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene is CCOC(CCCN)O[Si](OC)(OCC)OCC.Cc1ccccc1.
What is the InChIKey of (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene?
The InChIKey is MSPUYUOBSMKXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27NO5Si.C7H8/c1-5-14-11(9-8-10-12)17-18(13-4,15-6-2)16-7-3;1-7-5-3-2-4-6-7/h11H,5-10,12H2,1-4H3;2-6H,1H3.
What are the key properties of (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene?
(4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene has a molecular weight of 373.57 g/mol, XLogP of 3.25, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1-ethoxybutyl) diethyl methyl silicate;toluene is sourced from PubChem (CID 174801068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).