C17H31NO5Si — CID 174858587
(4-amino-1-ethoxy-1-phenylbutyl) diethyl methyl silicate (PubChem CID 174858587) has the molecular formula C17H31NO5Si and a molecular weight of 357.52 g/mol. Its IUPAC name is (4-amino-1-ethoxy-1-phenylbutyl) diethyl methyl silicate.
| Compound Name | (4-amino-1-ethoxy-1-phenylbutyl) diethyl methyl silicate |
|---|---|
| PubChem CID | 174858587 |
| Molecular Formula | C17H31NO5Si |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (4-amino-1-ethoxy-1-phenylbutyl) diethyl methyl silicate |
| SMILES | CCOC(CCCN)(O[Si](OC)(OCC)OCC)c1ccccc1 |
| InChI | InChI=1S/C17H31NO5Si/c1-5-20-17(14-11-15-18,16-12-9-8-10-13-16)23-24(19-4,21-6-2)22-7-3/h8-10,12-13H,5-7,11,14-15,18H2,1-4H3 |
| InChIKey | JQEMEONXYYQPFP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|