C14H26N2O3Si — CID 174890020
3-phenyl-5-trimethoxysilylpentane-1,3-diamine (PubChem CID 174890020) has the molecular formula C14H26N2O3Si and a molecular weight of 298.46 g/mol. Its IUPAC name is 3-phenyl-5-trimethoxysilylpentane-1,3-diamine.
| Compound Name | 3-phenyl-5-trimethoxysilylpentane-1,3-diamine |
|---|---|
| PubChem CID | 174890020 |
| Molecular Formula | C14H26N2O3Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-phenyl-5-trimethoxysilylpentane-1,3-diamine |
| SMILES | CO[Si](CCC(N)(CCN)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C14H26N2O3Si/c1-17-20(18-2,19-3)12-10-14(16,9-11-15)13-7-5-4-6-8-13/h4-8H,9-12,15-16H2,1-3H3 |
| InChIKey | CMFFNKIGCPFZBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|