C20H29NO3Si — CID 21018722
1,1-bis(3-methylphenyl)-3-trimethoxysilylpropan-1-amine (PubChem CID 21018722) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is 1,1-bis(3-methylphenyl)-3-trimethoxysilylpropan-1-amine.
| Compound Name | 1,1-bis(3-methylphenyl)-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 21018722 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1,1-bis(3-methylphenyl)-3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCC(N)(c1cccc(C)c1)c1cccc(C)c1)(OC)OC |
| InChI | InChI=1S/C20H29NO3Si/c1-16-8-6-10-18(14-16)20(21,19-11-7-9-17(2)15-19)12-13-25(22-3,23-4)24-5/h6-11,14-15H,12-13,21H2,1-5H3 |
| InChIKey | UVGRLXZCDNPBCM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|