C22H31NO4 — CID 154731977
4-(5,5-diethoxy-5-phenylpentoxy)-3-methoxyaniline (PubChem CID 154731977) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is 4-(5,5-diethoxy-5-phenylpentoxy)-3-methoxyaniline.
| Compound Name | 4-(5,5-diethoxy-5-phenylpentoxy)-3-methoxyaniline |
|---|---|
| PubChem CID | 154731977 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 4-(5,5-diethoxy-5-phenylpentoxy)-3-methoxyaniline |
| SMILES | CCOC(CCCCOc1ccc(N)cc1OC)(OCC)c1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c1-4-26-22(27-5-2,18-11-7-6-8-12-18)15-9-10-16-25-20-14-13-19(23)17-21(20)24-3/h6-8,11-14,17H,4-5,9-10,15-16,23H2,1-3H3 |
| InChIKey | PNQOAPPBKSEXKM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|